CAS 175135-60-1 is the registry number for 3-Bromo-5-chloro-2,6-dimethoxybenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-5-chloro-2,6-dimethoxybenzamide (CAS 175135-60-1) is a chemical compound with the molecular formula C9H9BrClNO3 and a molecular weight of 294.53 g/mol. IUPAC name: 3-bromo-5-chloro-2,6-dimethoxybenzamide. InChIKey: GBVBCQIVBHAEAZ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO3 |
|---|---|
| Molecular weight | 294.53 g/mol |
| IUPAC name | 3-bromo-5-chloro-2,6-dimethoxybenzamide |
| InChIKey | GBVBCQIVBHAEAZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1Cl)Br)OC)C(=O)N |
Computed by PubChem (NCBI)