Products 2960183-81-5
CAS 2960183-81-5 is the registry number for Methyl 4-(bromomethyl)-6-chloro-2-methoxynicotinate, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4-(bromomethyl)-6-chloro-2-methoxypyridine-3-carboxylate (CAS 2960183-81-5) is a chemical compound with the molecular formula C9H9BrClNO3 and a molecular weight of 294.53 g/mol. IUPAC name: methyl 4-(bromomethyl)-6-chloro-2-methoxypyridine-3-carboxylate. InChIKey: XHKWJHGMTWWBFB-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO3 |
|---|---|
| Molecular weight | 294.53 g/mol |
| IUPAC name | methyl 4-(bromomethyl)-6-chloro-2-methoxypyridine-3-carboxylate |
| InChIKey | XHKWJHGMTWWBFB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=N1)Cl)CBr)C(=O)OC |
Computed by PubChem (NCBI)