Products 175137-42-5

CAS 175137-42-5 is the registry number for Methyl 4,5-dibromo-3-methoxythiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 4,5-dibromo-3-methoxythiophene-2-carboxylate (CAS 175137-42-5) is a chemical compound with the molecular formula C7H6Br2O3S and a molecular weight of 330.00 g/mol. IUPAC name: methyl 4,5-dibromo-3-methoxythiophene-2-carboxylate. InChIKey: RDCDDWLASWJAGM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6Br2O3S
Molecular weight330.00 g/mol
IUPAC namemethyl 4,5-dibromo-3-methoxythiophene-2-carboxylate
InChIKeyRDCDDWLASWJAGM-UHFFFAOYSA-N
SMILESCOC1=C(SC(=C1Br)Br)C(=O)OC

Computed by PubChem (NCBI)