CAS 175137-42-5 is the registry number for Methyl 4,5-dibromo-3-methoxythiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 4,5-dibromo-3-methoxythiophene-2-carboxylate (CAS 175137-42-5) is a chemical compound with the molecular formula C7H6Br2O3S and a molecular weight of 330.00 g/mol. IUPAC name: methyl 4,5-dibromo-3-methoxythiophene-2-carboxylate. InChIKey: RDCDDWLASWJAGM-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2O3S |
|---|---|
| Molecular weight | 330.00 g/mol |
| IUPAC name | methyl 4,5-dibromo-3-methoxythiophene-2-carboxylate |
| InChIKey | RDCDDWLASWJAGM-UHFFFAOYSA-N |
| SMILES | COC1=C(SC(=C1Br)Br)C(=O)OC |
Computed by PubChem (NCBI)