CAS 755722-58-8 is the registry number for 3,5–Dibromo–4–methyl–benzenesulfonic acid. Offered by: GLPBio. Available pack sizes: 500mg.
3,5-dibromo-4-methylbenzenesulfonic acid (CAS 755722-58-8) is a chemical compound with the molecular formula C7H6Br2O3S and a molecular weight of 330.00 g/mol. IUPAC name: 3,5-dibromo-4-methylbenzenesulfonic acid. InChIKey: JRXLOIVAVLVEHD-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2O3S |
|---|---|
| Molecular weight | 330.00 g/mol |
| IUPAC name | 3,5-dibromo-4-methylbenzenesulfonic acid |
| InChIKey | JRXLOIVAVLVEHD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Br)S(=O)(=O)O)Br |
Computed by PubChem (NCBI)