CAS 17514-69-1 is the registry number for 7-Chloro-3-methyl-1λâ¶-benzothiophene-1,1-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-chloro-3-methyl-1-benzothiophene 1,1-dioxide (CAS 17514-69-1) is a chemical compound with the molecular formula C9H7ClO2S and a molecular weight of 214.67 g/mol. IUPAC name: 7-chloro-3-methyl-1-benzothiophene 1,1-dioxide. InChIKey: RVXUOIAUUUPODW-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2S |
|---|---|
| Molecular weight | 214.67 g/mol |
| IUPAC name | 7-chloro-3-methyl-1-benzothiophene 1,1-dioxide |
| InChIKey | RVXUOIAUUUPODW-UHFFFAOYSA-N |
| SMILES | CC1=CS(=O)(=O)C2=C1C=CC=C2Cl |
Computed by PubChem (NCBI)