CAS 26018-74-6 is the registry number for 6-Chloro-2,3-dihydrobenzo(b)thiophene-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloro-2,3-dihydro-1-benzothiophene-2-carboxylic acid (CAS 26018-74-6) is a chemical compound with the molecular formula C9H7ClO2S and a molecular weight of 214.67 g/mol. IUPAC name: 6-chloro-2,3-dihydro-1-benzothiophene-2-carboxylic acid. InChIKey: CDZHZOSUCIBINM-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2S |
|---|---|
| Molecular weight | 214.67 g/mol |
| IUPAC name | 6-chloro-2,3-dihydro-1-benzothiophene-2-carboxylic acid |
| InChIKey | CDZHZOSUCIBINM-UHFFFAOYSA-N |
| SMILES | C1C(SC2=C1C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)