CAS 175201-59-9 appears in our catalog under these names: 3-Amino-4-(phenylsulfonyl)thiophene-2-carboxylic acid, 95%, 3-Amino-4-(phenylsulfonyl)thiophene-2-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
3-amino-4-(benzenesulfonyl)thiophene-2-carboxylic acid (CAS 175201-59-9) is a chemical compound with the molecular formula C11H9NO4S2 and a molecular weight of 283.3 g/mol. IUPAC name: 3-amino-4-(benzenesulfonyl)thiophene-2-carboxylic acid. InChIKey: YXMYJEUQTGKJPV-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4S2 |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | 3-amino-4-(benzenesulfonyl)thiophene-2-carboxylic acid |
| InChIKey | YXMYJEUQTGKJPV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=CSC(=C2N)C(=O)O |
Computed by PubChem (NCBI)