Products 409364-78-9

CAS 409364-78-9 is the registry number for 3-[(Phenylsulfonyl)amino]thiophene-2-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-(benzenesulfonamido)thiophene-2-carboxylic acid (CAS 409364-78-9) is a chemical compound with the molecular formula C11H9NO4S2 and a molecular weight of 283.3 g/mol. IUPAC name: 3-(benzenesulfonamido)thiophene-2-carboxylic acid. InChIKey: BFPYDKRUFUMDTD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO4S2
Molecular weight283.3 g/mol
IUPAC name3-(benzenesulfonamido)thiophene-2-carboxylic acid
InChIKeyBFPYDKRUFUMDTD-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)S(=O)(=O)NC2=C(SC=C2)C(=O)O

Computed by PubChem (NCBI)