CAS 175202-55-8 appears in our catalog under these names: 3,4-Dimethylthieno[2,3-b]thiophene-2,5-dicarboxylic acid, 95%, 3,4–Dimethylthieno(2,3–b)thiophene–2,5–dicarboxylic acid, 3,4-Dimethylthieno[2,3-b]thiophene-2,5-dicarboxylic acid, 95%, 95%, 3,4-Dimethylthieno[2,3-b]thiophene-2,5-dicarboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g, 15g, 25g.
3,4-dimethylthieno[2,3-b]thiophene-2,5-dicarboxylic acid (CAS 175202-55-8) is a chemical compound with the molecular formula C10H8O4S2 and a molecular weight of 256.3 g/mol. IUPAC name: 3,4-dimethylthieno[2,3-b]thiophene-2,5-dicarboxylic acid. InChIKey: JARLNIWLMPUVAR-UHFFFAOYSA-N.
| Molecular formula | C10H8O4S2 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 3,4-dimethylthieno[2,3-b]thiophene-2,5-dicarboxylic acid |
| InChIKey | JARLNIWLMPUVAR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=C(S2)C(=O)O)C)C(=O)O |
Computed by PubChem (NCBI)