Products 300394-97-2
CAS 300394-97-2 is the registry number for Naphthalene-1,5-disulfinic acid, 90%. Offered by: Fluorochem. Available pack sizes: 1g.
Naphthalene-1,5-disulfinic acid (CAS 300394-97-2) is a chemical compound with the molecular formula C10H8O4S2 and a molecular weight of 256.3 g/mol. IUPAC name: naphthalene-1,5-disulfinic acid. InChIKey: RTVWSEDCSANSOD-UHFFFAOYSA-N.
| Molecular formula | C10H8O4S2 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | naphthalene-1,5-disulfinic acid |
| InChIKey | RTVWSEDCSANSOD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2S(=O)O)C(=C1)S(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Naphthalene-1,5-disulfinic Acid, starbld0045944