CAS 175204-58-7 is the registry number for 4-(3,5-Dichlorophenyl)-6-(methylthio)-1,3,5-triazin-2-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3,5-dichlorophenyl)-6-methylsulfanyl-1,3,5-triazin-2-amine (CAS 175204-58-7) is a chemical compound with the molecular formula C10H8Cl2N4S and a molecular weight of 287.17 g/mol. IUPAC name: 4-(3,5-dichlorophenyl)-6-methylsulfanyl-1,3,5-triazin-2-amine. InChIKey: SXOCLQPHHVCUJQ-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N4S |
|---|---|
| Molecular weight | 287.17 g/mol |
| IUPAC name | 4-(3,5-dichlorophenyl)-6-methylsulfanyl-1,3,5-triazin-2-amine |
| InChIKey | SXOCLQPHHVCUJQ-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=NC(=N1)N)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)