CAS 2055841-11-5 appears in our catalog under these names: 3-((3-Amino-2-chlorophenyl)thio)-6-chloropyrazin-2-amine, 95%+, 95%+, 3-((3-Amino-2-chlorophenyl)thio)-6-chloropyrazin-2-amine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-(3-amino-2-chlorophenyl)sulfanyl-6-chloropyrazin-2-amine (CAS 2055841-11-5) is a chemical compound with the molecular formula C10H8Cl2N4S and a molecular weight of 287.17 g/mol. IUPAC name: 3-(3-amino-2-chlorophenyl)sulfanyl-6-chloropyrazin-2-amine. InChIKey: VQAQTZNNHVMDPU-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N4S |
|---|---|
| Molecular weight | 287.17 g/mol |
| IUPAC name | 3-(3-amino-2-chlorophenyl)sulfanyl-6-chloropyrazin-2-amine |
| InChIKey | VQAQTZNNHVMDPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)SC2=NC=C(N=C2N)Cl)Cl)N |
Computed by PubChem (NCBI)