CAS 17526-94-2 appears in our catalog under these names: 3,3'–(4–Methyl–1,3–phenylene)bis(1,1–dimethylurea), 1,1'-(4-Methyl-1,3-phenylene)bis(3,3-dimethylurea), 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100g, 500g, 25g, 2.5kg.
3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea (CAS 17526-94-2) is a chemical compound with the molecular formula C13H20N4O2 and a molecular weight of 264.32 g/mol. IUPAC name: 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea. InChIKey: KDQTUCKOAOGTLT-UHFFFAOYSA-N.
| Molecular formula | C13H20N4O2 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea |
| InChIKey | KDQTUCKOAOGTLT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)N(C)C)NC(=O)N(C)C |
Computed by PubChem (NCBI)