CAS 175276-76-3 appears in our catalog under these names: 2-(2,6-Dichlorophenyl)ethanimidamide hydrochloride, 95%, 2-(2,6-Dichlorophenyl)ethanimidamide hydrochloride, 2-(2,6-Dichlorophenyl)ethanimidamide hydrochloride, 97% . Offered by: Combi-blocks, Biosynth, Thermo Scientific. Available pack sizes: 10g, 1g, 5g.
2-(2,6-dichlorophenyl)ethanimidamide;hydrochloride (CAS 175276-76-3) is a chemical compound with the molecular formula C8H9Cl3N2 and a molecular weight of 239.5 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)ethanimidamide;hydrochloride. InChIKey: YNPZJFKKDYCULJ-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl3N2 |
|---|---|
| Molecular weight | 239.5 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)ethanimidamide;hydrochloride |
| InChIKey | YNPZJFKKDYCULJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=N)N)Cl.Cl |
Computed by PubChem (NCBI)