CAS 2007916-41-6 is the registry number for 4-(Azetidin-3-yl)-2,6-dichloropyridine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 100mg, 1g, 250mg.
4-(azetidin-3-yl)-2,6-dichloropyridine;hydrochloride (CAS 2007916-41-6) is a chemical compound with the molecular formula C8H9Cl3N2 and a molecular weight of 239.5 g/mol. IUPAC name: 4-(azetidin-3-yl)-2,6-dichloropyridine;hydrochloride. InChIKey: KRINHPAWVVGNKU-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl3N2 |
|---|---|
| Molecular weight | 239.5 g/mol |
| IUPAC name | 4-(azetidin-3-yl)-2,6-dichloropyridine;hydrochloride |
| InChIKey | KRINHPAWVVGNKU-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=CC(=NC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)