CAS 175276-81-0 is the registry number for 3-(Trifluoromethyl)benzylsulfonyl acetonitrile, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
2-[[3-(trifluoromethyl)phenyl]methylsulfonyl]acetonitrile (CAS 175276-81-0) is a chemical compound with the molecular formula C10H8F3NO2S and a molecular weight of 263.24 g/mol. IUPAC name: 2-[[3-(trifluoromethyl)phenyl]methylsulfonyl]acetonitrile. InChIKey: MXAFRLGCENSSSL-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO2S |
|---|---|
| Molecular weight | 263.24 g/mol |
| IUPAC name | 2-[[3-(trifluoromethyl)phenyl]methylsulfonyl]acetonitrile |
| InChIKey | MXAFRLGCENSSSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CS(=O)(=O)CC#N |
Computed by PubChem (NCBI)