CAS 1955522-75-4 appears in our catalog under these names: 2-Methyl-4-(2,2,2-trifluoroethyl)-4h-thieno(3,2-b)pyrrole-5-carboxylic acid, 95%, 2-Methyl-4-(2,2,2-trifluoroethyl)-4H-thieno(3,2-b)pyrrole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-methyl-4-(2,2,2-trifluoroethyl)thieno[3,2-b]pyrrole-5-carboxylic acid (CAS 1955522-75-4) is a chemical compound with the molecular formula C10H8F3NO2S and a molecular weight of 263.24 g/mol. IUPAC name: 2-methyl-4-(2,2,2-trifluoroethyl)thieno[3,2-b]pyrrole-5-carboxylic acid. InChIKey: VDWDAPFVTHYTQD-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO2S |
|---|---|
| Molecular weight | 263.24 g/mol |
| IUPAC name | 2-methyl-4-(2,2,2-trifluoroethyl)thieno[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | VDWDAPFVTHYTQD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)C=C(N2CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)