CAS 175278-34-9 appears in our catalog under these names: N,N'-Di(2-bromophenyl)urea, 95%, 1,1-Bis(2-bromophenyl)urea, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
1,3-bis(2-bromophenyl)urea (CAS 175278-34-9) is a chemical compound with the molecular formula C13H10Br2N2O and a molecular weight of 370.04 g/mol. IUPAC name: 1,3-bis(2-bromophenyl)urea. InChIKey: KGIPPUCGBSFACI-UHFFFAOYSA-N.
| Molecular formula | C13H10Br2N2O |
|---|---|
| Molecular weight | 370.04 g/mol |
| IUPAC name | 1,3-bis(2-bromophenyl)urea |
| InChIKey | KGIPPUCGBSFACI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)NC2=CC=CC=C2Br)Br |
Computed by PubChem (NCBI)