CAS 6341-55-5 appears in our catalog under these names: 1,3-Bis(4-bromophenyl)urea, 98%, 1,3-Bis(4-bromophenyl)urea 95%. Offered by: AmBeed. Available pack sizes: 5g, 250mg, 1g.
1,3-bis(4-bromophenyl)urea (CAS 6341-55-5) is a chemical compound with the molecular formula C13H10Br2N2O and a molecular weight of 370.04 g/mol. IUPAC name: 1,3-bis(4-bromophenyl)urea. InChIKey: GQDAITKFYYUAJN-UHFFFAOYSA-N.
| Molecular formula | C13H10Br2N2O |
|---|---|
| Molecular weight | 370.04 g/mol |
| IUPAC name | 1,3-bis(4-bromophenyl)urea |
| InChIKey | GQDAITKFYYUAJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)NC2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)