CAS 175278-54-3 is the registry number for 5-Nitro-2-(2'-pyridinethio)benzaldehyde. Offered by: Biosynth. Available pack sizes: 50g, 100g.
5-nitro-2-pyridin-2-ylsulfanylbenzaldehyde (CAS 175278-54-3) is a chemical compound with the molecular formula C12H8N2O3S and a molecular weight of 260.27 g/mol. IUPAC name: 5-nitro-2-pyridin-2-ylsulfanylbenzaldehyde. InChIKey: DYCDKUHKWVDHJU-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O3S |
|---|---|
| Molecular weight | 260.27 g/mol |
| IUPAC name | 5-nitro-2-pyridin-2-ylsulfanylbenzaldehyde |
| InChIKey | DYCDKUHKWVDHJU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)SC2=C(C=C(C=C2)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)