CAS 175281-76-2 appears in our catalog under these names: 4-[4-(1-HYDROXYETHYL)-2-METHOXY-5-NITRO&, 4-(4-(1-Hydroxyethyl)-2-methoxy-5-nitrophenoxy)butanoic Acid, >95% (HPLC), 4–(4–(1–Hydroxyethyl)–2–methoxy–5–nitrophenoxy)butanoic acid, Acid-Photo-Linker, 4-(4-(1-Hydroxyethyl)-2-methoxy-5-nitrophenoxy)butyric acid. Offered by: Sigma-Aldrich, TRC, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 1G, 250mg, 5g, 10g, 0,1g, 0,25g, 0,5g, 2g.
4-[4-(1-hydroxyethyl)-2-methoxy-5-nitrophenoxy]butanoic acid (CAS 175281-76-2) is a chemical compound with the molecular formula C13H17NO7 and a molecular weight of 299.28 g/mol. IUPAC name: 4-[4-(1-hydroxyethyl)-2-methoxy-5-nitrophenoxy]butanoic acid. InChIKey: DUIJUTBRRZCWRD-UHFFFAOYSA-N.
| Molecular formula | C13H17NO7 |
|---|---|
| Molecular weight | 299.28 g/mol |
| IUPAC name | 4-[4-(1-hydroxyethyl)-2-methoxy-5-nitrophenoxy]butanoic acid |
| InChIKey | DUIJUTBRRZCWRD-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1[N+](=O)[O-])OCCCC(=O)O)OC)O |
Computed by PubChem (NCBI)