CAS 201274-07-9 appears in our catalog under these names: H–Thr–OBzl·oxalate, H-Thr-OBzl·Oxalate 98%, (2S,3R)-Benzyl 2-amino-3-hydroxybutanoate oxalate, 98%, 98%, H-Thr-OBzl.oxalate. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g.
Benzyl (2S,3R)-2-amino-3-hydroxybutanoate;oxalic acid (CAS 201274-07-9) is a chemical compound with the molecular formula C13H17NO7 and a molecular weight of 299.28 g/mol. IUPAC name: benzyl (2S,3R)-2-amino-3-hydroxybutanoate;oxalic acid. InChIKey: SXBVEEGVIGATLZ-SCYNACPDSA-N.
| Molecular formula | C13H17NO7 |
|---|---|
| Molecular weight | 299.28 g/mol |
| IUPAC name | benzyl (2S,3R)-2-amino-3-hydroxybutanoate;oxalic acid |
| InChIKey | SXBVEEGVIGATLZ-SCYNACPDSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OCC1=CC=CC=C1)N)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)