CAS 17533-36-7 appears in our catalog under these names: 2,7–Dibromo–4,5,9,10–tetrahydropyrene, 2,7-Dibromo-4,5,9,10-tetrahydropyrene, 90%, 90%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
2,7-dibromo-4,5,9,10-tetrahydropyrene (CAS 17533-36-7) is a chemical compound with the molecular formula C16H12Br2 and a molecular weight of 364.07 g/mol. IUPAC name: 2,7-dibromo-4,5,9,10-tetrahydropyrene. InChIKey: DECWZAKGNGDEQE-UHFFFAOYSA-N.
| Molecular formula | C16H12Br2 |
|---|---|
| Molecular weight | 364.07 g/mol |
| IUPAC name | 2,7-dibromo-4,5,9,10-tetrahydropyrene |
| InChIKey | DECWZAKGNGDEQE-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=CC3=C2C4=C(CC3)C=C(C=C41)Br)Br |
Computed by PubChem (NCBI)