Products 55373-68-7
CAS 55373-68-7 is the registry number for (1Z,3Z)-1,4-Dibromo-1,4-diphenylbuta-1,3-diene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[(1Z,3Z)-1,4-dibromo-4-phenylbuta-1,3-dienyl]benzene (CAS 55373-68-7) is a chemical compound with the molecular formula C16H12Br2 and a molecular weight of 364.07 g/mol. IUPAC name: [(1Z,3Z)-1,4-dibromo-4-phenylbuta-1,3-dienyl]benzene. InChIKey: VYKJGULDTAGCMJ-NFLUSIDLSA-N.
| Molecular formula | C16H12Br2 |
|---|---|
| Molecular weight | 364.07 g/mol |
| IUPAC name | [(1Z,3Z)-1,4-dibromo-4-phenylbuta-1,3-dienyl]benzene |
| InChIKey | VYKJGULDTAGCMJ-NFLUSIDLSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C/C=C(\Br)/C2=CC=CC=C2)/Br |
Computed by PubChem (NCBI)