Products 1755-01-7
CAS 1755-01-7 is the registry number for Endo-dicyclopentadiene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
(1R,2S,6R,7S)-tricyclo[5.2.1.02,6]deca-3,8-diene (CAS 1755-01-7) is a chemical compound with the molecular formula C10H12 and a molecular weight of 132.20 g/mol. IUPAC name: (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]deca-3,8-diene. InChIKey: HECLRDQVFMWTQS-QCLAVDOMSA-N.
| Molecular formula | C10H12 |
|---|---|
| Molecular weight | 132.20 g/mol |
| IUPAC name | (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]deca-3,8-diene |
| InChIKey | HECLRDQVFMWTQS-QCLAVDOMSA-N |
| SMILES | C1C=C[C@@H]2[C@H]1[C@H]3C[C@@H]2C=C3 |
Computed by PubChem (NCBI)