Products 933-60-8
CAS 933-60-8 is the registry number for exo-Cyclopentadiene Dimer (80% Purity). Offered by: TRC. Available pack sizes: 100mg.
(1S,2S,6R,7R)-tricyclo[5.2.1.02,6]deca-3,8-diene (CAS 933-60-8) is a chemical compound with the molecular formula C10H12 and a molecular weight of 132.20 g/mol. IUPAC name: (1S,2S,6R,7R)-tricyclo[5.2.1.02,6]deca-3,8-diene. InChIKey: HECLRDQVFMWTQS-XFWSIPNHSA-N.
| Molecular formula | C10H12 |
|---|---|
| Molecular weight | 132.20 g/mol |
| IUPAC name | (1S,2S,6R,7R)-tricyclo[5.2.1.02,6]deca-3,8-diene |
| InChIKey | HECLRDQVFMWTQS-XFWSIPNHSA-N |
| SMILES | C1C=C[C@@H]2[C@H]1[C@@H]3C[C@H]2C=C3 |
Computed by PubChem (NCBI)
Synonyms:
Dicyclopentadiene. exo-, EXO-DICYCLOPENTADIENE, exo-Cyclopentadiene Dimer (80% Purity), exo-Tricyclo[5.2.1.02,6]deca-3,8-diene, 4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro-, (3aR,4R,7S,7aS)-rel-, rel-(3aR,4R,7S,7aS)-3a,4,7,7a-Tetrahydro-4,7-methano-1H-indene, 4,7-Methano-1H-indene, 3a,4,7,7a-tetrahydro-, (3aalpha,4beta,7beta,7aalpha)-