CAS 175521-95-6 is the registry number for AGN 192403. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,2S,3S,4R)-3-propan-2-ylbicyclo[2.2.1]heptan-2-amine (CAS 175521-95-6) is a chemical compound with the molecular formula C10H19N and a molecular weight of 153.26 g/mol. IUPAC name: (1S,2S,3S,4R)-3-propan-2-ylbicyclo[2.2.1]heptan-2-amine. InChIKey: SHXVJSFOJHMEEQ-KATARQTJSA-N.
| Molecular formula | C10H19N |
|---|---|
| Molecular weight | 153.26 g/mol |
| IUPAC name | (1S,2S,3S,4R)-3-propan-2-ylbicyclo[2.2.1]heptan-2-amine |
| InChIKey | SHXVJSFOJHMEEQ-KATARQTJSA-N |
| SMILES | CC(C)[C@H]1[C@@H]2CC[C@@H](C2)[C@@H]1N |
Computed by PubChem (NCBI)