Products 175688-79-6
CAS 175688-79-6 appears in our catalog under these names: Clevidipine Impurity 13, Clevidipine Impurity F, Clevidipine butyrate impurity vii, 95%. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
Bis(2-cyanoethyl) 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 175688-79-6) is a chemical compound with the molecular formula C21H19Cl2N3O4 and a molecular weight of 448.3 g/mol. IUPAC name: bis(2-cyanoethyl) 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: CYRXPMAQIWZHMN-UHFFFAOYSA-N.
| Molecular formula | C21H19Cl2N3O4 |
|---|---|
| Molecular weight | 448.3 g/mol |
| IUPAC name | bis(2-cyanoethyl) 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | CYRXPMAQIWZHMN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OCCC#N)C2=C(C(=CC=C2)Cl)Cl)C(=O)OCCC#N |
Computed by PubChem (NCBI)