CAS 2724727-55-1 is the registry number for N-Desmethylpiperazine Hydroxy Bosutinib. Offered by: TRC. Available pack sizes: 100mg, 250mg.
4-(2,4-dichloro-5-methoxyanilino)-7-(3-hydroxypropoxy)-6-methoxyquinoline-3-carbonitrile (CAS 2724727-55-1) is a chemical compound with the molecular formula C21H19Cl2N3O4 and a molecular weight of 448.3 g/mol. IUPAC name: 4-(2,4-dichloro-5-methoxyanilino)-7-(3-hydroxypropoxy)-6-methoxyquinoline-3-carbonitrile. InChIKey: HNRGAWYZIAVHLJ-UHFFFAOYSA-N.
| Molecular formula | C21H19Cl2N3O4 |
|---|---|
| Molecular weight | 448.3 g/mol |
| IUPAC name | 4-(2,4-dichloro-5-methoxyanilino)-7-(3-hydroxypropoxy)-6-methoxyquinoline-3-carbonitrile |
| InChIKey | HNRGAWYZIAVHLJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=C(C=N2)C#N)NC3=CC(=C(C=C3Cl)Cl)OC)OCCCO |
Computed by PubChem (NCBI)