CAS 175838-97-8 is the registry number for 4-(1,1,2,2-Tetrafluoroethoxy)biphenyl. Offered by: TRC. Available pack sizes: 500mg.
1-phenyl-4-(1,1,2,2-tetrafluoroethoxy)benzene (CAS 175838-97-8) is a chemical compound with the molecular formula C14H10F4O and a molecular weight of 270.22 g/mol. IUPAC name: 1-phenyl-4-(1,1,2,2-tetrafluoroethoxy)benzene. InChIKey: GVGJKEPWOWWQEO-UHFFFAOYSA-N.
| Molecular formula | C14H10F4O |
|---|---|
| Molecular weight | 270.22 g/mol |
| IUPAC name | 1-phenyl-4-(1,1,2,2-tetrafluoroethoxy)benzene |
| InChIKey | GVGJKEPWOWWQEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)OC(C(F)F)(F)F |
Computed by PubChem (NCBI)