CAS 508212-01-9 is the registry number for 3-Fluoro-α-[4-(trifluoromethyl)phenyl]benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3-fluorophenyl)-[4-(trifluoromethyl)phenyl]methanol (CAS 508212-01-9) is a chemical compound with the molecular formula C14H10F4O and a molecular weight of 270.22 g/mol. IUPAC name: (3-fluorophenyl)-[4-(trifluoromethyl)phenyl]methanol. InChIKey: LAAUDANNSIVWRV-UHFFFAOYSA-N.
| Molecular formula | C14H10F4O |
|---|---|
| Molecular weight | 270.22 g/mol |
| IUPAC name | (3-fluorophenyl)-[4-(trifluoromethyl)phenyl]methanol |
| InChIKey | LAAUDANNSIVWRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(C2=CC=C(C=C2)C(F)(F)F)O |
Computed by PubChem (NCBI)