CAS 1759-26-8 is the registry number for 4-Sulfate Aminoantipyrine. Offered by: Chemat Brand. Available pack sizes: on request.
(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamic acid (CAS 1759-26-8) is a chemical compound with the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. IUPAC name: (1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamic acid. InChIKey: PNOGVLDQOYEVSD-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O4S |
|---|---|
| Molecular weight | 283.31 g/mol |
| IUPAC name | (1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamic acid |
| InChIKey | PNOGVLDQOYEVSD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)NS(=O)(=O)O |
Computed by PubChem (NCBI)