CAS 851116-21-7 appears in our catalog under these names: 5-(Morpholin-4-ylsulfonyl)-1,3-benzoxazol-2-amine, 95%, 5-(Morpholine-4-sulfonyl)-1,3-benzoxazol-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
5-morpholin-4-ylsulfonyl-1,3-benzoxazol-2-amine (CAS 851116-21-7) is a chemical compound with the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. IUPAC name: 5-morpholin-4-ylsulfonyl-1,3-benzoxazol-2-amine. InChIKey: WXFJVTBRUSNYSR-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O4S |
|---|---|
| Molecular weight | 283.31 g/mol |
| IUPAC name | 5-morpholin-4-ylsulfonyl-1,3-benzoxazol-2-amine |
| InChIKey | WXFJVTBRUSNYSR-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC3=C(C=C2)OC(=N3)N |
Computed by PubChem (NCBI)