Products 17605-03-7
CAS 17605-03-7 is the registry number for 2-Methoxy-4-methylphenyl benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(2-methoxy-4-methylphenyl) benzoate (CAS 17605-03-7) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: (2-methoxy-4-methylphenyl) benzoate. InChIKey: RHDJPHCNQZJYBI-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | (2-methoxy-4-methylphenyl) benzoate |
| InChIKey | RHDJPHCNQZJYBI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC(=O)C2=CC=CC=C2)OC |
Computed by PubChem (NCBI)