Products 176050-48-9
CAS 176050-48-9 is the registry number for Zerumin A. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, Get quote.
(Z)-5-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-formylpent-3-enoic acid (CAS 176050-48-9) is a chemical compound with the molecular formula C20H30O3 and a molecular weight of 318.4 g/mol. IUPAC name: (Z)-5-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-formylpent-3-enoic acid. InChIKey: ZAWWSYIDZKWRAI-DTFKRFDDSA-N.
| Molecular formula | C20H30O3 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (Z)-5-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-formylpent-3-enoic acid |
| InChIKey | ZAWWSYIDZKWRAI-DTFKRFDDSA-N |
| SMILES | C[C@]12CCCC([C@@H]1CCC(=C)[C@@H]2C/C=C(/CC(=O)O)\C=O)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Zerumin A