Products 176088-59-8
CAS 176088-59-8 appears in our catalog under these names: 6–Bromo–2–methyl–2，3–dihydro–1H–inden–1–one, 6-Bromo-2-methyl-2,3-dihydroinden-1-one, 6-Bromo-2-methyl-2,3-dihydro-1H-inden-1-one 98%, 6-Bromo-2-methyl-2,3-dihydro-1H-inden-1-one, 97%, 97%, 6-Bromo-2-methyl-2,3-dihydro-1H-inden-1-one, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 10g, 250mg, 5g, 25g, 500mg.
6-bromo-2-methyl-2,3-dihydroinden-1-one (CAS 176088-59-8) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-2-methyl-2,3-dihydroinden-1-one. InChIKey: GMJKJIUETGRADG-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 6-bromo-2-methyl-2,3-dihydroinden-1-one |
| InChIKey | GMJKJIUETGRADG-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)