CAS 1762-32-9 is the registry number for 3,3'–Dimethyl–2,2'–bipyridine. Offered by: GLPBio. Available pack sizes: 5g.
3-methyl-2-(3-methyl-2-pyridinyl)pyridine (CAS 1762-32-9) is a chemical compound with the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. IUPAC name: 3-methyl-2-(3-methyl-2-pyridinyl)pyridine. InChIKey: GALLWSLKCWDSLT-UHFFFAOYSA-N.
| Molecular formula | C12H12N2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | 3-methyl-2-(3-methyl-2-pyridinyl)pyridine |
| InChIKey | GALLWSLKCWDSLT-UHFFFAOYSA-N |
| SMILES | CC1=C(N=CC=C1)C2=C(C=CC=N2)C |
Computed by PubChem (NCBI)