Products 17649-59-1
CAS 17649-59-1 appears in our catalog under these names: Dimethyl 4，5–dimethylphthalate, Dimethyl 4,5-dimethylphthalate 98%, 1,2-Dimethyl 4,5-dimethyl-1,2-benzenedicarboxylate, 98%, 98%, Dimethyl 4,5-dimethylphthalate, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
Dimethyl 4,5-dimethylbenzene-1,2-dicarboxylate (CAS 17649-59-1) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: dimethyl 4,5-dimethylbenzene-1,2-dicarboxylate. InChIKey: BMODQQWZCVNPKL-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | dimethyl 4,5-dimethylbenzene-1,2-dicarboxylate |
| InChIKey | BMODQQWZCVNPKL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
1,2-Dimethyl 4,5-dimethyl-1,2-benzenedicarboxylate, Dimethyl 4,5-dimethylphthalate, dimethyl 4,5-dimethylbenzene-1,2-dicarboxylate, 1,2-Benzenedicarboxylic acid, 4,5-dimethyl-, 1,2-dimethyl ester, 1,2-dimethyl 4,5-dimethylbenzene-1,2-dicarboxylate, Dimethyl 4,5-dimethylphthalate #, 4,5-dimethyl-phthalic acid dimethyl ester, Phthalic acid, 4,5-dimethyl-, dimethyl ester