CAS 17665-00-8 is the registry number for D–Leu–D–Val–OH. Offered by: GLPBio. Available pack sizes: 1g, 5g.
(2R)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoic acid (CAS 17665-00-8) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: (2R)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoic acid. InChIKey: MDSUKZSLOATHMH-DTWKUNHWSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | (2R)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoic acid |
| InChIKey | MDSUKZSLOATHMH-DTWKUNHWSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@H](C(C)C)C(=O)O)N |
Computed by PubChem (NCBI)