CAS 176689-86-4 is the registry number for 3-(Quinolin-2-yl)phenanthro(9,10-e)(1,2,4)triazine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
3-quinolin-2-ylphenanthro[9,10-e][1,2,4]triazine (CAS 176689-86-4) is a chemical compound with the molecular formula C24H14N4 and a molecular weight of 358.4 g/mol. IUPAC name: 3-quinolin-2-ylphenanthro[9,10-e][1,2,4]triazine. InChIKey: CNOOBTHHSJUAPD-UHFFFAOYSA-N.
| Molecular formula | C24H14N4 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | 3-quinolin-2-ylphenanthro[9,10-e][1,2,4]triazine |
| InChIKey | CNOOBTHHSJUAPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C3=NC4=C(C5=CC=CC=C5C6=CC=CC=C64)N=N3 |
Computed by PubChem (NCBI)