CAS 96761-79-4 appears in our catalog under these names: 5,5'–Bi(1,10–phenanthroline), 5,5'-Bi(1,10-phenanthroline), 97%, 97%, 5,5'-Bi(1,10-phenanthroline), 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 50mg, 100mg, 1g.
5-(1,10-phenanthrolin-5-yl)-1,10-phenanthroline (CAS 96761-79-4) is a chemical compound with the molecular formula C24H14N4 and a molecular weight of 358.4 g/mol. IUPAC name: 5-(1,10-phenanthrolin-5-yl)-1,10-phenanthroline. InChIKey: MBMOTAGBXPKECR-UHFFFAOYSA-N.
| Molecular formula | C24H14N4 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | 5-(1,10-phenanthrolin-5-yl)-1,10-phenanthroline |
| InChIKey | MBMOTAGBXPKECR-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C3C=CC=NC3=C2N=C1)C4=C5C=CC=NC5=C6C(=C4)C=CC=N6 |
Computed by PubChem (NCBI)