Products 176690-89-4
CAS 176690-89-4 appears in our catalog under these names: (2E)-3-(4-tert-Butylphenyl)acryloyl chloride, 95%, (E)-3-(4-(tert-Butyl)phenyl)acryloyl chloride 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 250mg, 1g, 100mg.
(E)-3-(4-tert-butylphenyl)prop-2-enoyl chloride (CAS 176690-89-4) is a chemical compound with the molecular formula C13H15ClO and a molecular weight of 222.71 g/mol. IUPAC name: (E)-3-(4-tert-butylphenyl)prop-2-enoyl chloride. InChIKey: IEBJAFJYVRUQCO-RMKNXTFCSA-N.
| Molecular formula | C13H15ClO |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | (E)-3-(4-tert-butylphenyl)prop-2-enoyl chloride |
| InChIKey | IEBJAFJYVRUQCO-RMKNXTFCSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)/C=C/C(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
(2E)-3-(4-tert-Butylphenyl)prop-2-enoyl chloride, (E)-3-(4-tert-butylphenyl)prop-2-enoyl chloride, (E)-3-(4-(tert-Butyl)phenyl)acryloyl chloride, 2-propenoyl chloride, 3-[4-(1,1-dimethylethyl)phenyl]-, (2E)-, 3-(4-tert-Butyl-phenyl)-acryloyl chloride, 2-propenoyl chloride, 3-[4-(1,1-dimethylethyl)phenyl]-, (2, 2-Propenoyl chloride, 3-[4-(1,1-dimethylethyl)phenyl]-, (E)- (9CI)