CAS 91405-41-3 appears in our catalog under these names: 3-(4-(tert-Butyl)phenyl)-3-chloroacrylaldehyde, 98%, (2Z)-3-(4-tert-Butylphenyl)-3-chloroprop-2-enal, 98%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g.
(Z)-3-(4-tert-butylphenyl)-3-chloroprop-2-enal (CAS 91405-41-3) is a chemical compound with the molecular formula C13H15ClO and a molecular weight of 222.71 g/mol. IUPAC name: (Z)-3-(4-tert-butylphenyl)-3-chloroprop-2-enal. InChIKey: DRBVXRZJVCWQMN-WQLSENKSSA-N.
| Molecular formula | C13H15ClO |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | (Z)-3-(4-tert-butylphenyl)-3-chloroprop-2-enal |
| InChIKey | DRBVXRZJVCWQMN-WQLSENKSSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)/C(=C/C=O)/Cl |
Computed by PubChem (NCBI)