CAS 176707-78-1 is the registry number for (2S)-6-Bromo-1,2,3,4-tetrahydro-2-naphthalenamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S)-6-bromo-1,2,3,4-tetrahydronaphthalen-2-amine (CAS 176707-78-1) is a chemical compound with the molecular formula C10H12BrN and a molecular weight of 226.11 g/mol. IUPAC name: (2S)-6-bromo-1,2,3,4-tetrahydronaphthalen-2-amine. InChIKey: WMALPFDUOAVVMB-JTQLQIEISA-N.
| Molecular formula | C10H12BrN |
|---|---|
| Molecular weight | 226.11 g/mol |
| IUPAC name | (2S)-6-bromo-1,2,3,4-tetrahydronaphthalen-2-amine |
| InChIKey | WMALPFDUOAVVMB-JTQLQIEISA-N |
| SMILES | C1CC2=C(C[C@H]1N)C=CC(=C2)Br |
Computed by PubChem (NCBI)