CAS 176722-54-6 is the registry number for 4-((4-Bromophenyl)amino)-1,1,1-trifluorobut-3-en-2-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(E)-4-(4-bromoanilino)-1,1,1-trifluorobut-3-en-2-one (CAS 176722-54-6) is a chemical compound with the molecular formula C10H7BrF3NO and a molecular weight of 294.07 g/mol. IUPAC name: (E)-4-(4-bromoanilino)-1,1,1-trifluorobut-3-en-2-one. InChIKey: VBODWDWEPNVSJO-AATRIKPKSA-N.
| Molecular formula | C10H7BrF3NO |
|---|---|
| Molecular weight | 294.07 g/mol |
| IUPAC name | (E)-4-(4-bromoanilino)-1,1,1-trifluorobut-3-en-2-one |
| InChIKey | VBODWDWEPNVSJO-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1N/C=C/C(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)