Products 2637450-62-3
CAS 2637450-62-3 is the registry number for 4-Bromo-1-(2,2,2-trifluoroethyl)indolin-2-one, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-1-(2,2,2-trifluoroethyl)-3H-indol-2-one (CAS 2637450-62-3) is a chemical compound with the molecular formula C10H7BrF3NO and a molecular weight of 294.07 g/mol. IUPAC name: 4-bromo-1-(2,2,2-trifluoroethyl)-3H-indol-2-one. InChIKey: ZQPAOBUPHLVUPD-UHFFFAOYSA-N.
| Molecular formula | C10H7BrF3NO |
|---|---|
| Molecular weight | 294.07 g/mol |
| IUPAC name | 4-bromo-1-(2,2,2-trifluoroethyl)-3H-indol-2-one |
| InChIKey | ZQPAOBUPHLVUPD-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2Br)N(C1=O)CC(F)(F)F |
Computed by PubChem (NCBI)