Products 17696-61-6
CAS 17696-61-6 appears in our catalog under these names: 4-Hydroxybenzoic acid sec-butyl ester, 98%, Butan-2-yl 4-Hydroxybenzoate, >95% (HPLC), sec-Butyl 4-hydroxybenzoate, 98%, butan-2-yl 4-hydroxybenzoate, sec-Butyl 4-Hydroxybenzoate, >98.0%(HPLC)(T). Offered by: Combi-blocks, TRC, AmBeed, Biosynth, TCI. Available pack sizes: 100g, 1g, 25g, 5g, 2,5g, 250mg, 500mg, 500g.
Butan-2-yl 4-hydroxybenzoate (CAS 17696-61-6) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: butan-2-yl 4-hydroxybenzoate. InChIKey: ZUOTXZHOGPQFIU-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | butan-2-yl 4-hydroxybenzoate |
| InChIKey | ZUOTXZHOGPQFIU-UHFFFAOYSA-N |
| SMILES | CCC(C)OC(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)
Synonyms:
sec-Butyl 4-hydroxybenzoate, Benzoic acid, 4-hydroxy-, 1-methylpropyl ester, 2-Butyl p-hydroxybenzoate, SEC-BUTYL P-HYDROXYBENZOATE, SEC-BUTYL PARABEN, BENZOIC ACID, P-HYDROXY-, SEC-BUTYL ESTER, butan-2-yl 4-hydroxybenzoate, sec-Butylparaben, 4-Hydroxybenzoic Acid sec-Butyl Ester, sec-Butyl4-Hydroxybenzoate