CAS 176960-47-7 is the registry number for BMS-193884. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1,3-oxazol-2-yl)phenyl]benzenesulfonamide (CAS 176960-47-7) is a chemical compound with the molecular formula C20H17N3O4S and a molecular weight of 395.4 g/mol. IUPAC name: N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1,3-oxazol-2-yl)phenyl]benzenesulfonamide. InChIKey: LJGUZUROJOJEMI-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O4S |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1,3-oxazol-2-yl)phenyl]benzenesulfonamide |
| InChIKey | LJGUZUROJOJEMI-UHFFFAOYSA-N |
| SMILES | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 |
Computed by PubChem (NCBI)