Products 2389060-50-6
CAS 2389060-50-6 is the registry number for Linvemastat. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[3-[4-[(2-methyl-4-pyridinyl)methoxy]phenyl]sulfanylfuran-2-yl]imidazolidine-2,4-dione (CAS 2389060-50-6) is a chemical compound with the molecular formula C20H17N3O4S and a molecular weight of 395.4 g/mol. IUPAC name: 5-[3-[4-[(2-methyl-4-pyridinyl)methoxy]phenyl]sulfanylfuran-2-yl]imidazolidine-2,4-dione. InChIKey: GUKPADSDFUIAMC-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O4S |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 5-[3-[4-[(2-methyl-4-pyridinyl)methoxy]phenyl]sulfanylfuran-2-yl]imidazolidine-2,4-dione |
| InChIKey | GUKPADSDFUIAMC-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1)COC2=CC=C(C=C2)SC3=C(OC=C3)C4C(=O)NC(=O)N4 |
Computed by PubChem (NCBI)