Products 176982-20-0
CAS 176982-20-0 appears in our catalog under these names: Ergothioneine Impurity 3, S-Methyl Ergothioneine, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg.
3-(2-methylsulfanyl-1H-imidazol-5-yl)-2-(trimethylazaniumyl)propanoate (CAS 176982-20-0) is a chemical compound with the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. IUPAC name: 3-(2-methylsulfanyl-1H-imidazol-5-yl)-2-(trimethylazaniumyl)propanoate. InChIKey: GVQNHIYBRMFCMS-UHFFFAOYSA-N.
| Molecular formula | C10H17N3O2S |
|---|---|
| Molecular weight | 243.33 g/mol |
| IUPAC name | 3-(2-methylsulfanyl-1H-imidazol-5-yl)-2-(trimethylazaniumyl)propanoate |
| InChIKey | GVQNHIYBRMFCMS-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C(CC1=CN=C(N1)SC)C(=O)[O-] |
Computed by PubChem (NCBI)